About 1,5-bis(diethoxyphosphorylmethyl)-2,4-dimethylbenzene
1,5-bis(diethoxyphosphorylmethyl)-2,4-dimethylbenzene (PubChem CID 10787490) has the molecular formula C18H32O6P2
and a molecular weight of 406.40 g/mol. Its IUPAC name is 1,5-bis(diethoxyphosphorylmethyl)-2,4-dimethylbenzene.
Molecular Properties
| Compound Name | 1,5-bis(diethoxyphosphorylmethyl)-2,4-dimethylbenzene |
| PubChem CID | 10787490 |
| Molecular Formula | C18H32O6P2 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 1,5-bis(diethoxyphosphorylmethyl)-2,4-dimethylbenzene |
| SMILES | CCOP(=O)(Cc1cc(CP(=O)(OCC)OCC)c(C)cc1C)OCC |
| InChI | InChI=1S/C18H32O6P2/c1-7-21-25(19,22-8-2)13-17-12-18(16(6)11-15(17)5)14-26(20,23-9-3)24-10-4/h11-12H,7-10,13-14H2,1-6H3 |
| InChIKey | TZIVKFFJHJSKID-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,5-bis(diethoxyphosphorylmethyl)-2,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-bis(diethoxyphosphorylmethyl)-2,4-dimethylbenzene?
The IUPAC name of 1,5-bis(diethoxyphosphorylmethyl)-2,4-dimethylbenzene (CID 10787490) is 1,5-bis(diethoxyphosphorylmethyl)-2,4-dimethylbenzene.
What is the SMILES notation for 1,5-bis(diethoxyphosphorylmethyl)-2,4-dimethylbenzene?
The canonical SMILES for 1,5-bis(diethoxyphosphorylmethyl)-2,4-dimethylbenzene is CCOP(=O)(Cc1cc(CP(=O)(OCC)OCC)c(C)cc1C)OCC.
What is the InChIKey of 1,5-bis(diethoxyphosphorylmethyl)-2,4-dimethylbenzene?
The InChIKey is TZIVKFFJHJSKID-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O6P2/c1-7-21-25(19,22-8-2)13-17-12-18(16(6)11-15(17)5)14-26(20,23-9-3)24-10-4/h11-12H,7-10,13-14H2,1-6H3.
What are the key properties of 1,5-bis(diethoxyphosphorylmethyl)-2,4-dimethylbenzene?
1,5-bis(diethoxyphosphorylmethyl)-2,4-dimethylbenzene has a molecular weight of 406.40 g/mol, XLogP of 5.84, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-bis(diethoxyphosphorylmethyl)-2,4-dimethylbenzene is sourced from PubChem (CID 10787490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).