C22H30O7 — CID 10787508
(E)-3-[(2S,3S)-3-[(2E,4E)-11-hydroxy-4,6-dimethyldodeca-2,4-dienoyl]oxy-6-oxo-2,3-dihydropyran-2-yl]prop-2-enoic acid (PubChem CID 10787508) has the molecular formula C22H30O7 and a molecular weight of 406.48 g/mol. Its IUPAC name is (E)-3-[(2S,3S)-3-[(2E,4E)-11-hydroxy-4,6-dimethyldodeca-2,4-dienoyl]oxy-6-oxo-2,3-dihydropyran-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[(2S,3S)-3-[(2E,4E)-11-hydroxy-4,6-dimethyldodeca-2,4-dienoyl]oxy-6-oxo-2,3-dihydropyran-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 10787508 |
| Molecular Formula | C22H30O7 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | (E)-3-[(2S,3S)-3-[(2E,4E)-11-hydroxy-4,6-dimethyldodeca-2,4-dienoyl]oxy-6-oxo-2,3-dihydropyran-2-yl]prop-2-enoic acid |
| SMILES | CC(/C=C/C(=O)O[C@H]1C=CC(=O)O[C@H]1/C=C/C(=O)O)=C\C(C)CCCCC(C)O |
| InChI | InChI=1S/C22H30O7/c1-15(6-4-5-7-17(3)23)14-16(2)8-12-21(26)29-19-10-13-22(27)28-18(19)9-11-20(24)25/h8-15,17-19,23H,4-7H2,1-3H3,(H,24,25)/b11-9+,12-8+,16-14+/t15?,17?,18-,19-/m0/s1 |
| InChIKey | JDUDUAQYAOKPNE-LGFSKDTGSA-N |
| XLogP | 3.10 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|