C19H29N — CID 107876225
N-(2,2-dicyclopropylethyl)-3-methyl-2-phenylbutan-1-amine (PubChem CID 107876225) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is N-(2,2-dicyclopropylethyl)-3-methyl-2-phenylbutan-1-amine.
| Compound Name | N-(2,2-dicyclopropylethyl)-3-methyl-2-phenylbutan-1-amine |
|---|---|
| PubChem CID | 107876225 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | N-(2,2-dicyclopropylethyl)-3-methyl-2-phenylbutan-1-amine |
| SMILES | CC(C)C(CNCC(C1CC1)C1CC1)c1ccccc1 |
| InChI | InChI=1S/C19H29N/c1-14(2)18(15-6-4-3-5-7-15)12-20-13-19(16-8-9-16)17-10-11-17/h3-7,14,16-20H,8-13H2,1-2H3 |
| InChIKey | IKOIHLMOYIYUDJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |