C21H36N2O4Si — CID 10787627
[(3aR,4S,6R,7R,7aR)-4-(3-aminophenyl)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-6-yl]methanol (PubChem CID 10787627) has the molecular formula C21H36N2O4Si and a molecular weight of 408.62 g/mol. Its IUPAC name is [(3aR,4S,6R,7R,7aR)-4-(3-aminophenyl)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-6-yl]methanol.
| Compound Name | [(3aR,4S,6R,7R,7aR)-4-(3-aminophenyl)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-6-yl]methanol |
|---|---|
| PubChem CID | 10787627 |
| Molecular Formula | C21H36N2O4Si |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | [(3aR,4S,6R,7R,7aR)-4-(3-aminophenyl)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-6-yl]methanol |
| SMILES | CC1(C)O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)N[C@@H](c3cccc(N)c3)[C@H]2O1 |
| InChI | InChI=1S/C21H36N2O4Si/c1-20(2,3)28(6,7)27-17-15(12-24)23-16(13-9-8-10-14(22)11-13)18-19(17)26-21(4,5)25-18/h8-11,15-19,23-24H,12,22H2,1-7H3/t15-,16+,17-,18-,19+/m1/s1 |
| InChIKey | VZOPYXCWUHUXIT-ZRSRNVLSSA-N |
| XLogP | 3.18 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|