C25H50O2Si — CID 10787741
(5E,7S,8S,9E)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyloctadeca-5,9-dien-7-ol (PubChem CID 10787741) has the molecular formula C25H50O2Si and a molecular weight of 410.76 g/mol. Its IUPAC name is (5E,7S,8S,9E)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyloctadeca-5,9-dien-7-ol.
| Compound Name | (5E,7S,8S,9E)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyloctadeca-5,9-dien-7-ol |
|---|---|
| PubChem CID | 10787741 |
| Molecular Formula | C25H50O2Si |
| Molecular Weight | 410.76 g/mol |
| Exact Mass | 410.36 |
| IUPAC Name | (5E,7S,8S,9E)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyloctadeca-5,9-dien-7-ol |
| SMILES | CCCCCCCC/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)/C=C/CCC(C)C |
| InChI | InChI=1S/C25H50O2Si/c1-9-10-11-12-13-14-15-16-21-24(27-28(7,8)25(4,5)6)23(26)20-18-17-19-22(2)3/h16,18,20-24,26H,9-15,17,19H2,1-8H3/b20-18+,21-16+/t23-,24-/m0/s1 |
| InChIKey | BDEZJWKRCKPUIX-RZSJYPSFSA-N |
| XLogP | 8.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.76 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|