C12H17FN2S — CID 107878107
[2-fluoro-5-(thiomorpholin-4-ylmethyl)phenyl]methanamine (PubChem CID 107878107) has the molecular formula C12H17FN2S and a molecular weight of 240.35 g/mol. Its IUPAC name is [2-fluoro-5-(thiomorpholin-4-ylmethyl)phenyl]methanamine.
| Compound Name | [2-fluoro-5-(thiomorpholin-4-ylmethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 107878107 |
| Molecular Formula | C12H17FN2S |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | [2-fluoro-5-(thiomorpholin-4-ylmethyl)phenyl]methanamine |
| SMILES | NCc1cc(CN2CCSCC2)ccc1F |
| InChI | InChI=1S/C12H17FN2S/c13-12-2-1-10(7-11(12)8-14)9-15-3-5-16-6-4-15/h1-2,7H,3-6,8-9,14H2 |
| InChIKey | SMAZHNPZLSQUHP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |