C18H25NO8S — CID 10787996
[3-[[(5S,6R)-2,2-dimethyl-6-methylsulfonyloxy-1,3-dioxepan-5-yl]carbamoyl]-2-methylphenyl] acetate (PubChem CID 10787996) has the molecular formula C18H25NO8S and a molecular weight of 415.46 g/mol. Its IUPAC name is [3-[[(5S,6R)-2,2-dimethyl-6-methylsulfonyloxy-1,3-dioxepan-5-yl]carbamoyl]-2-methylphenyl] acetate.
| Compound Name | [3-[[(5S,6R)-2,2-dimethyl-6-methylsulfonyloxy-1,3-dioxepan-5-yl]carbamoyl]-2-methylphenyl] acetate |
|---|---|
| PubChem CID | 10787996 |
| Molecular Formula | C18H25NO8S |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | [3-[[(5S,6R)-2,2-dimethyl-6-methylsulfonyloxy-1,3-dioxepan-5-yl]carbamoyl]-2-methylphenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)N[C@H]2COC(C)(C)OC[C@@H]2OS(C)(=O)=O)c1C |
| InChI | InChI=1S/C18H25NO8S/c1-11-13(7-6-8-15(11)26-12(2)20)17(21)19-14-9-24-18(3,4)25-10-16(14)27-28(5,22)23/h6-8,14,16H,9-10H2,1-5H3,(H,19,21)/t14-,16-/m0/s1 |
| InChIKey | ZTJYOIGNPFHVOT-HOCLYGCPSA-N |
| XLogP | 1.15 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|