C23H29FO4Si — CID 10788072
[(2R,3S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluorooxolan-2-yl] acetate (PubChem CID 10788072) has the molecular formula C23H29FO4Si and a molecular weight of 416.57 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluorooxolan-2-yl] acetate.
| Compound Name | [(2R,3S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluorooxolan-2-yl] acetate |
|---|---|
| PubChem CID | 10788072 |
| Molecular Formula | C23H29FO4Si |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | [(2R,3S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluorooxolan-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1O[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@@H]1F |
| InChI | InChI=1S/C23H29FO4Si/c1-17(25)27-22-21(24)15-18(28-22)16-26-29(23(2,3)4,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-14,18,21-22H,15-16H2,1-4H3/t18-,21+,22+/m1/s1 |
| InChIKey | SNEMZRPTEPGRFO-COPCDDAFSA-N |
| XLogP | 3.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|