C24H34O6 — CID 10788170
[(1R,2S,3R,4R)-3-[(1R,2S,3S)-3-acetyloxy-2-methyl-5-oxocyclopentyl]-2-formyl-4-[(2Z)-6-methylhepta-2,5-dien-2-yl]cyclopentyl] acetate (PubChem CID 10788170) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is [(1R,2S,3R,4R)-3-[(1R,2S,3S)-3-acetyloxy-2-methyl-5-oxocyclopentyl]-2-formyl-4-[(2Z)-6-methylhepta-2,5-dien-2-yl]cyclopentyl] acetate.
| Compound Name | [(1R,2S,3R,4R)-3-[(1R,2S,3S)-3-acetyloxy-2-methyl-5-oxocyclopentyl]-2-formyl-4-[(2Z)-6-methylhepta-2,5-dien-2-yl]cyclopentyl] acetate |
|---|---|
| PubChem CID | 10788170 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | [(1R,2S,3R,4R)-3-[(1R,2S,3S)-3-acetyloxy-2-methyl-5-oxocyclopentyl]-2-formyl-4-[(2Z)-6-methylhepta-2,5-dien-2-yl]cyclopentyl] acetate |
| SMILES | CC(=O)O[C@H]1CC(=O)[C@H]([C@H]2[C@H](C=O)[C@H](OC(C)=O)C[C@H]2/C(C)=C\CC=C(C)C)[C@@H]1C |
| InChI | InChI=1S/C24H34O6/c1-13(2)8-7-9-14(3)18-10-22(30-17(6)27)19(12-25)24(18)23-15(4)21(11-20(23)28)29-16(5)26/h8-9,12,15,18-19,21-24H,7,10-11H2,1-6H3/b14-9-/t15-,18+,19-,21+,22-,23-,24-/m1/s1 |
| InChIKey | FKIQYVQHXPZBHS-IJDGTOCUSA-N |
| XLogP | 3.83 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|