C16H20FN3 — CID 107883111
5-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]-2-fluorobenzonitrile (PubChem CID 107883111) has the molecular formula C16H20FN3 and a molecular weight of 273.35 g/mol. Its IUPAC name is 5-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]-2-fluorobenzonitrile.
| Compound Name | 5-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 107883111 |
| Molecular Formula | C16H20FN3 |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 5-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]-2-fluorobenzonitrile |
| SMILES | CC1(C)C2CNCC2CN1Cc1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C16H20FN3/c1-16(2)14-8-19-7-13(14)10-20(16)9-11-3-4-15(17)12(5-11)6-18/h3-5,13-14,19H,7-10H2,1-2H3 |
| InChIKey | KAFBTWCIHKJKLI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |