C15H18ClFN2 — CID 107883300
N-[[1-[(4-chloro-3-fluorophenyl)methyl]pyrrol-2-yl]methyl]propan-2-amine (PubChem CID 107883300) has the molecular formula C15H18ClFN2 and a molecular weight of 280.77 g/mol. Its IUPAC name is N-[[1-[(4-chloro-3-fluorophenyl)methyl]pyrrol-2-yl]methyl]propan-2-amine.
| Compound Name | N-[[1-[(4-chloro-3-fluorophenyl)methyl]pyrrol-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 107883300 |
| Molecular Formula | C15H18ClFN2 |
| Molecular Weight | 280.77 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | N-[[1-[(4-chloro-3-fluorophenyl)methyl]pyrrol-2-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1cccn1Cc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C15H18ClFN2/c1-11(2)18-9-13-4-3-7-19(13)10-12-5-6-14(16)15(17)8-12/h3-8,11,18H,9-10H2,1-2H3 |
| InChIKey | XPQATXJLTOJXMH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.77 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |