C16H15ClFN — CID 107883808
2-[(4-chloro-3-fluorophenyl)methyl]-1,3-dihydroinden-2-amine (PubChem CID 107883808) has the molecular formula C16H15ClFN and a molecular weight of 275.75 g/mol. Its IUPAC name is 2-[(4-chloro-3-fluorophenyl)methyl]-1,3-dihydroinden-2-amine.
| Compound Name | 2-[(4-chloro-3-fluorophenyl)methyl]-1,3-dihydroinden-2-amine |
|---|---|
| PubChem CID | 107883808 |
| Molecular Formula | C16H15ClFN |
| Molecular Weight | 275.75 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-[(4-chloro-3-fluorophenyl)methyl]-1,3-dihydroinden-2-amine |
| SMILES | NC1(Cc2ccc(Cl)c(F)c2)Cc2ccccc2C1 |
| InChI | InChI=1S/C16H15ClFN/c17-14-6-5-11(7-15(14)18)8-16(19)9-12-3-1-2-4-13(12)10-16/h1-7H,8-10,19H2 |
| InChIKey | UIYGOEQFMVGXBN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.75 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |