C11H10ClFN2O — CID 107884317
2-(4-chloro-3-fluorophenyl)-1-(1H-imidazol-2-yl)ethanol (PubChem CID 107884317) has the molecular formula C11H10ClFN2O and a molecular weight of 240.67 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenyl)-1-(1H-imidazol-2-yl)ethanol.
| Compound Name | 2-(4-chloro-3-fluorophenyl)-1-(1H-imidazol-2-yl)ethanol |
|---|---|
| PubChem CID | 107884317 |
| Molecular Formula | C11H10ClFN2O |
| Molecular Weight | 240.67 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 2-(4-chloro-3-fluorophenyl)-1-(1H-imidazol-2-yl)ethanol |
| SMILES | OC(Cc1ccc(Cl)c(F)c1)c1ncc[nH]1 |
| InChI | InChI=1S/C11H10ClFN2O/c12-8-2-1-7(5-9(8)13)6-10(16)11-14-3-4-15-11/h1-5,10,16H,6H2,(H,14,15) |
| InChIKey | OPTCAFQMPCXXCP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.67 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |