C16H16ClF2NS — CID 107884855
1-(4-chloro-3-fluorophenyl)-3-(4-fluorophenyl)sulfanyl-N-methylpropan-2-amine (PubChem CID 107884855) has the molecular formula C16H16ClF2NS and a molecular weight of 327.83 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-3-(4-fluorophenyl)sulfanyl-N-methylpropan-2-amine.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-3-(4-fluorophenyl)sulfanyl-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 107884855 |
| Molecular Formula | C16H16ClF2NS |
| Molecular Weight | 327.83 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-3-(4-fluorophenyl)sulfanyl-N-methylpropan-2-amine |
| SMILES | CNC(CSc1ccc(F)cc1)Cc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C16H16ClF2NS/c1-20-13(8-11-2-7-15(17)16(19)9-11)10-21-14-5-3-12(18)4-6-14/h2-7,9,13,20H,8,10H2,1H3 |
| InChIKey | NWYVSPFIBVRBNN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.83 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |