C15H15BrClFN2 — CID 107885135
1-(3-bromo-2-pyridinyl)-2-(4-chloro-3-fluorophenyl)-N-ethylethanamine (PubChem CID 107885135) has the molecular formula C15H15BrClFN2 and a molecular weight of 357.65 g/mol. Its IUPAC name is 1-(3-bromo-2-pyridinyl)-2-(4-chloro-3-fluorophenyl)-N-ethylethanamine.
| Compound Name | 1-(3-bromo-2-pyridinyl)-2-(4-chloro-3-fluorophenyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 107885135 |
| Molecular Formula | C15H15BrClFN2 |
| Molecular Weight | 357.65 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 1-(3-bromo-2-pyridinyl)-2-(4-chloro-3-fluorophenyl)-N-ethylethanamine |
| SMILES | CCNC(Cc1ccc(Cl)c(F)c1)c1ncccc1Br |
| InChI | InChI=1S/C15H15BrClFN2/c1-2-19-14(15-11(16)4-3-7-20-15)9-10-5-6-12(17)13(18)8-10/h3-8,14,19H,2,9H2,1H3 |
| InChIKey | NJZLSTBRZJZXJW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.65 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |