C17H25ClFNO — CID 107885231
2-(4-chloro-3-fluorophenyl)-1-(1-ethoxy-4-methylcyclohexyl)ethanamine (PubChem CID 107885231) has the molecular formula C17H25ClFNO and a molecular weight of 313.84 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenyl)-1-(1-ethoxy-4-methylcyclohexyl)ethanamine.
| Compound Name | 2-(4-chloro-3-fluorophenyl)-1-(1-ethoxy-4-methylcyclohexyl)ethanamine |
|---|---|
| PubChem CID | 107885231 |
| Molecular Formula | C17H25ClFNO |
| Molecular Weight | 313.84 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 2-(4-chloro-3-fluorophenyl)-1-(1-ethoxy-4-methylcyclohexyl)ethanamine |
| SMILES | CCOC1(C(N)Cc2ccc(Cl)c(F)c2)CCC(C)CC1 |
| InChI | InChI=1S/C17H25ClFNO/c1-3-21-17(8-6-12(2)7-9-17)16(20)11-13-4-5-14(18)15(19)10-13/h4-5,10,12,16H,3,6-9,11,20H2,1-2H3 |
| InChIKey | WSWRMLNEVKAFOL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.84 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |