C24H29ClN2O3 — CID 10788686
4-[2-[1-(5-chloro-2-piperidin-1-ylphenyl)butylamino]-2-oxoethyl]benzoic acid (PubChem CID 10788686) has the molecular formula C24H29ClN2O3 and a molecular weight of 428.96 g/mol. Its IUPAC name is 4-[2-[1-(5-chloro-2-piperidin-1-ylphenyl)butylamino]-2-oxoethyl]benzoic acid.
| Compound Name | 4-[2-[1-(5-chloro-2-piperidin-1-ylphenyl)butylamino]-2-oxoethyl]benzoic acid |
|---|---|
| PubChem CID | 10788686 |
| Molecular Formula | C24H29ClN2O3 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 4-[2-[1-(5-chloro-2-piperidin-1-ylphenyl)butylamino]-2-oxoethyl]benzoic acid |
| SMILES | CCCC(NC(=O)Cc1ccc(C(=O)O)cc1)c1cc(Cl)ccc1N1CCCCC1 |
| InChI | InChI=1S/C24H29ClN2O3/c1-2-6-21(26-23(28)15-17-7-9-18(10-8-17)24(29)30)20-16-19(25)11-12-22(20)27-13-4-3-5-14-27/h7-12,16,21H,2-6,13-15H2,1H3,(H,26,28)(H,29,30) |
| InChIKey | TVSZIMCWXIAULW-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |