C22H42O6Si — CID 10788780
prop-2-enyl (3R,7S,9R)-7-acetyloxy-9-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-methyldecanoate (PubChem CID 10788780) has the molecular formula C22H42O6Si and a molecular weight of 430.66 g/mol. Its IUPAC name is prop-2-enyl (3R,7S,9R)-7-acetyloxy-9-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-methyldecanoate.
| Compound Name | prop-2-enyl (3R,7S,9R)-7-acetyloxy-9-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-methyldecanoate |
|---|---|
| PubChem CID | 10788780 |
| Molecular Formula | C22H42O6Si |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | prop-2-enyl (3R,7S,9R)-7-acetyloxy-9-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-methyldecanoate |
| SMILES | C=CCOC(=O)C[C@](C)(O)CCC[C@@H](C[C@@H](C)O[Si](C)(C)C(C)(C)C)OC(C)=O |
| InChI | InChI=1S/C22H42O6Si/c1-10-14-26-20(24)16-22(7,25)13-11-12-19(27-18(3)23)15-17(2)28-29(8,9)21(4,5)6/h10,17,19,25H,1,11-16H2,2-9H3/t17-,19+,22-/m1/s1 |
| InChIKey | FFVHKPXLEZYTGJ-ZWCUEREDSA-N |
| XLogP | 4.76 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|