C16H30N2O2 — CID 107888908
3,3,6-triethyl-6-methyl-1-pentan-2-ylpiperazine-2,5-dione (PubChem CID 107888908) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 3,3,6-triethyl-6-methyl-1-pentan-2-ylpiperazine-2,5-dione.
| Compound Name | 3,3,6-triethyl-6-methyl-1-pentan-2-ylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 107888908 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 3,3,6-triethyl-6-methyl-1-pentan-2-ylpiperazine-2,5-dione |
| SMILES | CCCC(C)N1C(=O)C(CC)(CC)NC(=O)C1(C)CC |
| InChI | InChI=1S/C16H30N2O2/c1-7-11-12(5)18-14(20)16(9-3,10-4)17-13(19)15(18,6)8-2/h12H,7-11H2,1-6H3,(H,17,19) |
| InChIKey | VRIYAXTZRVUYQB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |