About methyl N-[2-[3,5-dibromo-4-[3-(dimethylamino)propoxy]phenyl]ethyl]carbamate
methyl N-[2-[3,5-dibromo-4-[3-(dimethylamino)propoxy]phenyl]ethyl]carbamate (PubChem CID 10789141) has the molecular formula C15H22Br2N2O3
and a molecular weight of 438.16 g/mol. Its IUPAC name is methyl N-[2-[3,5-dibromo-4-[3-(dimethylamino)propoxy]phenyl]ethyl]carbamate.
Molecular Properties
| Compound Name | methyl N-[2-[3,5-dibromo-4-[3-(dimethylamino)propoxy]phenyl]ethyl]carbamate |
| PubChem CID | 10789141 |
| Molecular Formula | C15H22Br2N2O3 |
| Molecular Weight | 438.16 g/mol |
| Exact Mass | 436.00 |
| IUPAC Name | methyl N-[2-[3,5-dibromo-4-[3-(dimethylamino)propoxy]phenyl]ethyl]carbamate |
| SMILES | COC(=O)NCCc1cc(Br)c(OCCCN(C)C)c(Br)c1 |
| InChI | InChI=1S/C15H22Br2N2O3/c1-19(2)7-4-8-22-14-12(16)9-11(10-13(14)17)5-6-18-15(20)21-3/h9-10H,4-8H2,1-3H3,(H,18,20) |
| InChIKey | JDJDJZOZXACFJD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.16 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[2-[3,5-dibromo-4-[3-(dimethylamino)propoxy]phenyl]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[2-[3,5-dibromo-4-[3-(dimethylamino)propoxy]phenyl]ethyl]carbamate?
The IUPAC name of methyl N-[2-[3,5-dibromo-4-[3-(dimethylamino)propoxy]phenyl]ethyl]carbamate (CID 10789141) is methyl N-[2-[3,5-dibromo-4-[3-(dimethylamino)propoxy]phenyl]ethyl]carbamate.
What is the SMILES notation for methyl N-[2-[3,5-dibromo-4-[3-(dimethylamino)propoxy]phenyl]ethyl]carbamate?
The canonical SMILES for methyl N-[2-[3,5-dibromo-4-[3-(dimethylamino)propoxy]phenyl]ethyl]carbamate is COC(=O)NCCc1cc(Br)c(OCCCN(C)C)c(Br)c1.
What is the InChIKey of methyl N-[2-[3,5-dibromo-4-[3-(dimethylamino)propoxy]phenyl]ethyl]carbamate?
The InChIKey is JDJDJZOZXACFJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22Br2N2O3/c1-19(2)7-4-8-22-14-12(16)9-11(10-13(14)17)5-6-18-15(20)21-3/h9-10H,4-8H2,1-3H3,(H,18,20).
What are the key properties of methyl N-[2-[3,5-dibromo-4-[3-(dimethylamino)propoxy]phenyl]ethyl]carbamate?
methyl N-[2-[3,5-dibromo-4-[3-(dimethylamino)propoxy]phenyl]ethyl]carbamate has a molecular weight of 438.16 g/mol, XLogP of 3.44, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[2-[3,5-dibromo-4-[3-(dimethylamino)propoxy]phenyl]ethyl]carbamate is sourced from PubChem (CID 10789141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).