C11H11ClFN3S — CID 107891535
2-(4-chloro-3-fluorophenyl)-1-(4-methylthiadiazol-5-yl)ethanamine (PubChem CID 107891535) has the molecular formula C11H11ClFN3S and a molecular weight of 271.75 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenyl)-1-(4-methylthiadiazol-5-yl)ethanamine.
| Compound Name | 2-(4-chloro-3-fluorophenyl)-1-(4-methylthiadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 107891535 |
| Molecular Formula | C11H11ClFN3S |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 2-(4-chloro-3-fluorophenyl)-1-(4-methylthiadiazol-5-yl)ethanamine |
| SMILES | Cc1nnsc1C(N)Cc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C11H11ClFN3S/c1-6-11(17-16-15-6)10(14)5-7-2-3-8(12)9(13)4-7/h2-4,10H,5,14H2,1H3 |
| InChIKey | MYKZLUORSXDFNE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |