C15H26N2O9P2 — CID 10789220
[(2R,3S)-2-[[2-cyanoethoxy(ethoxy)phosphoryl]oxymethyl]oxolan-3-yl] 2-cyanoethyl ethyl phosphate (PubChem CID 10789220) has the molecular formula C15H26N2O9P2 and a molecular weight of 440.33 g/mol. Its IUPAC name is [(2R,3S)-2-[[2-cyanoethoxy(ethoxy)phosphoryl]oxymethyl]oxolan-3-yl] 2-cyanoethyl ethyl phosphate.
| Compound Name | [(2R,3S)-2-[[2-cyanoethoxy(ethoxy)phosphoryl]oxymethyl]oxolan-3-yl] 2-cyanoethyl ethyl phosphate |
|---|---|
| PubChem CID | 10789220 |
| Molecular Formula | C15H26N2O9P2 |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | [(2R,3S)-2-[[2-cyanoethoxy(ethoxy)phosphoryl]oxymethyl]oxolan-3-yl] 2-cyanoethyl ethyl phosphate |
| SMILES | CCOP(=O)(OCCC#N)OC[C@H]1OCC[C@@H]1OP(=O)(OCC)OCCC#N |
| InChI | InChI=1S/C15H26N2O9P2/c1-3-21-27(18,23-10-5-8-16)25-13-15-14(7-12-20-15)26-28(19,22-4-2)24-11-6-9-17/h14-15H,3-7,10-13H2,1-2H3/t14-,15+,27?,28?/m0/s1 |
| InChIKey | FKINSJBYGKPSPI-NLNHBIJHSA-N |
| XLogP | 3.33 |
| TPSA | 146.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|