About [(2R,3S)-2-[[2-cyanoethoxy(ethoxy)phosphoryl]oxymethyl]oxolan-3-yl] 2-cyanoethyl ethyl phosphate
[(2R,3S)-2-[[2-cyanoethoxy(ethoxy)phosphoryl]oxymethyl]oxolan-3-yl] 2-cyanoethyl ethyl phosphate (PubChem CID 10789220) has the molecular formula C15H26N2O9P2
and a molecular weight of 440.33 g/mol. Its IUPAC name is [(2R,3S)-2-[[2-cyanoethoxy(ethoxy)phosphoryl]oxymethyl]oxolan-3-yl] 2-cyanoethyl ethyl phosphate.
Molecular Properties
| Compound Name | [(2R,3S)-2-[[2-cyanoethoxy(ethoxy)phosphoryl]oxymethyl]oxolan-3-yl] 2-cyanoethyl ethyl phosphate |
| PubChem CID | 10789220 |
| Molecular Formula | C15H26N2O9P2 |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | [(2R,3S)-2-[[2-cyanoethoxy(ethoxy)phosphoryl]oxymethyl]oxolan-3-yl] 2-cyanoethyl ethyl phosphate |
| SMILES | CCOP(=O)(OCCC#N)OC[C@H]1OCC[C@@H]1OP(=O)(OCC)OCCC#N |
| InChI | InChI=1S/C15H26N2O9P2/c1-3-21-27(18,23-10-5-8-16)25-13-15-14(7-12-20-15)26-28(19,22-4-2)24-11-6-9-17/h14-15H,3-7,10-13H2,1-2H3/t14-,15+,27?,28?/m0/s1 |
| InChIKey | FKINSJBYGKPSPI-NLNHBIJHSA-N |
| XLogP | 3.33 |
| TPSA | 146.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(2R,3S)-2-[[2-cyanoethoxy(ethoxy)phosphoryl]oxymethyl]oxolan-3-yl] 2-cyanoethyl ethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3S)-2-[[2-cyanoethoxy(ethoxy)phosphoryl]oxymethyl]oxolan-3-yl] 2-cyanoethyl ethyl phosphate?
The IUPAC name of [(2R,3S)-2-[[2-cyanoethoxy(ethoxy)phosphoryl]oxymethyl]oxolan-3-yl] 2-cyanoethyl ethyl phosphate (CID 10789220) is [(2R,3S)-2-[[2-cyanoethoxy(ethoxy)phosphoryl]oxymethyl]oxolan-3-yl] 2-cyanoethyl ethyl phosphate.
What is the SMILES notation for [(2R,3S)-2-[[2-cyanoethoxy(ethoxy)phosphoryl]oxymethyl]oxolan-3-yl] 2-cyanoethyl ethyl phosphate?
The canonical SMILES for [(2R,3S)-2-[[2-cyanoethoxy(ethoxy)phosphoryl]oxymethyl]oxolan-3-yl] 2-cyanoethyl ethyl phosphate is CCOP(=O)(OCCC#N)OC[C@H]1OCC[C@@H]1OP(=O)(OCC)OCCC#N.
What is the InChIKey of [(2R,3S)-2-[[2-cyanoethoxy(ethoxy)phosphoryl]oxymethyl]oxolan-3-yl] 2-cyanoethyl ethyl phosphate?
The InChIKey is FKINSJBYGKPSPI-NLNHBIJHSA-N. The full InChI is InChI=1S/C15H26N2O9P2/c1-3-21-27(18,23-10-5-8-16)25-13-15-14(7-12-20-15)26-28(19,22-4-2)24-11-6-9-17/h14-15H,3-7,10-13H2,1-2H3/t14-,15+,27?,28?/m0/s1.
What are the key properties of [(2R,3S)-2-[[2-cyanoethoxy(ethoxy)phosphoryl]oxymethyl]oxolan-3-yl] 2-cyanoethyl ethyl phosphate?
[(2R,3S)-2-[[2-cyanoethoxy(ethoxy)phosphoryl]oxymethyl]oxolan-3-yl] 2-cyanoethyl ethyl phosphate has a molecular weight of 440.33 g/mol, XLogP of 3.33, 15 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3S)-2-[[2-cyanoethoxy(ethoxy)phosphoryl]oxymethyl]oxolan-3-yl] 2-cyanoethyl ethyl phosphate is sourced from PubChem (CID 10789220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).