About N-[[ethoxy(phenyl)phosphoryl]methyl]-1,1,1-triphenylmethanamine
N-[[ethoxy(phenyl)phosphoryl]methyl]-1,1,1-triphenylmethanamine (PubChem CID 10789278) has the molecular formula C28H28NO2P
and a molecular weight of 441.51 g/mol. Its IUPAC name is N-[[ethoxy(phenyl)phosphoryl]methyl]-1,1,1-triphenylmethanamine.
Molecular Properties
| Compound Name | N-[[ethoxy(phenyl)phosphoryl]methyl]-1,1,1-triphenylmethanamine |
| PubChem CID | 10789278 |
| Molecular Formula | C28H28NO2P |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | N-[[ethoxy(phenyl)phosphoryl]methyl]-1,1,1-triphenylmethanamine |
| SMILES | CCOP(=O)(CNC(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H28NO2P/c1-2-31-32(30,27-21-13-6-14-22-27)23-29-28(24-15-7-3-8-16-24,25-17-9-4-10-18-25)26-19-11-5-12-20-26/h3-22,29H,2,23H2,1H3 |
| InChIKey | YEMJTRKYQIVQOS-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze N-[[ethoxy(phenyl)phosphoryl]methyl]-1,1,1-triphenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[ethoxy(phenyl)phosphoryl]methyl]-1,1,1-triphenylmethanamine?
The IUPAC name of N-[[ethoxy(phenyl)phosphoryl]methyl]-1,1,1-triphenylmethanamine (CID 10789278) is N-[[ethoxy(phenyl)phosphoryl]methyl]-1,1,1-triphenylmethanamine.
What is the SMILES notation for N-[[ethoxy(phenyl)phosphoryl]methyl]-1,1,1-triphenylmethanamine?
The canonical SMILES for N-[[ethoxy(phenyl)phosphoryl]methyl]-1,1,1-triphenylmethanamine is CCOP(=O)(CNC(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of N-[[ethoxy(phenyl)phosphoryl]methyl]-1,1,1-triphenylmethanamine?
The InChIKey is YEMJTRKYQIVQOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28NO2P/c1-2-31-32(30,27-21-13-6-14-22-27)23-29-28(24-15-7-3-8-16-24,25-17-9-4-10-18-25)26-19-11-5-12-20-26/h3-22,29H,2,23H2,1H3.
What are the key properties of N-[[ethoxy(phenyl)phosphoryl]methyl]-1,1,1-triphenylmethanamine?
N-[[ethoxy(phenyl)phosphoryl]methyl]-1,1,1-triphenylmethanamine has a molecular weight of 441.51 g/mol, XLogP of 6.17, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[ethoxy(phenyl)phosphoryl]methyl]-1,1,1-triphenylmethanamine is sourced from PubChem (CID 10789278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).