C26H38N2O4 — CID 10789341
(1S,4R)-N-[(1S,2S)-2-[[(1S,4R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbonyl]amino]cyclohexyl]-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 10789341) has the molecular formula C26H38N2O4 and a molecular weight of 442.60 g/mol. Its IUPAC name is (1S,4R)-N-[(1S,2S)-2-[[(1S,4R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbonyl]amino]cyclohexyl]-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (1S,4R)-N-[(1S,2S)-2-[[(1S,4R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbonyl]amino]cyclohexyl]-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 10789341 |
| Molecular Formula | C26H38N2O4 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | (1S,4R)-N-[(1S,2S)-2-[[(1S,4R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbonyl]amino]cyclohexyl]-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C(=O)N[C@H]1CCCC[C@@H]1NC(=O)[C@]13CC[C@H](CC1=O)C3(C)C)C(=O)C2 |
| InChI | InChI=1S/C26H38N2O4/c1-23(2)15-9-11-25(23,19(29)13-15)21(31)27-17-7-5-6-8-18(17)28-22(32)26-12-10-16(14-20(26)30)24(26,3)4/h15-18H,5-14H2,1-4H3,(H,27,31)(H,28,32)/t15-,16-,17+,18+,25+,26+/m1/s1 |
| InChIKey | YOYQWAFNGGZEOU-IYGDFLNFSA-N |
| XLogP | 3.32 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|