C27H26ClN3O — CID 10789410
1-[4-(13-chloro-6-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-2-pyridin-3-ylethanone (PubChem CID 10789410) has the molecular formula C27H26ClN3O and a molecular weight of 443.98 g/mol. Its IUPAC name is 1-[4-(13-chloro-6-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-2-pyridin-3-ylethanone.
| Compound Name | 1-[4-(13-chloro-6-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-2-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 10789410 |
| Molecular Formula | C27H26ClN3O |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 1-[4-(13-chloro-6-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-2-pyridin-3-ylethanone |
| SMILES | Cc1cnc2c(c1)CCc1cc(Cl)ccc1C2=C1CCN(C(=O)Cc2cccnc2)CC1 |
| InChI | InChI=1S/C27H26ClN3O/c1-18-13-22-5-4-21-15-23(28)6-7-24(21)26(27(22)30-16-18)20-8-11-31(12-9-20)25(32)14-19-3-2-10-29-17-19/h2-3,6-7,10,13,15-17H,4-5,8-9,11-12,14H2,1H3 |
| InChIKey | MGWLKIQUEZCJEU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |