C14H16ClFN4O — CID 107894341
5-[2-aminoethyl(methyl)amino]-2-[(4-chloro-3-fluorophenyl)methyl]pyridazin-3-one (PubChem CID 107894341) has the molecular formula C14H16ClFN4O and a molecular weight of 310.76 g/mol. Its IUPAC name is 5-[2-aminoethyl(methyl)amino]-2-[(4-chloro-3-fluorophenyl)methyl]pyridazin-3-one.
| Compound Name | 5-[2-aminoethyl(methyl)amino]-2-[(4-chloro-3-fluorophenyl)methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 107894341 |
| Molecular Formula | C14H16ClFN4O |
| Molecular Weight | 310.76 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 5-[2-aminoethyl(methyl)amino]-2-[(4-chloro-3-fluorophenyl)methyl]pyridazin-3-one |
| SMILES | CN(CCN)c1cnn(Cc2ccc(Cl)c(F)c2)c(=O)c1 |
| InChI | InChI=1S/C14H16ClFN4O/c1-19(5-4-17)11-7-14(21)20(18-8-11)9-10-2-3-12(15)13(16)6-10/h2-3,6-8H,4-5,9,17H2,1H3 |
| InChIKey | MZNJLOLQUOFJMM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.76 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |