C14H15ClFN3 — CID 107895008
[2-(4-chloro-3-fluorophenyl)-1-(6-methyl-2-pyridinyl)ethyl]hydrazine (PubChem CID 107895008) has the molecular formula C14H15ClFN3 and a molecular weight of 279.75 g/mol. Its IUPAC name is [2-(4-chloro-3-fluorophenyl)-1-(6-methyl-2-pyridinyl)ethyl]hydrazine.
| Compound Name | [2-(4-chloro-3-fluorophenyl)-1-(6-methyl-2-pyridinyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 107895008 |
| Molecular Formula | C14H15ClFN3 |
| Molecular Weight | 279.75 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | [2-(4-chloro-3-fluorophenyl)-1-(6-methyl-2-pyridinyl)ethyl]hydrazine |
| SMILES | Cc1cccc(C(Cc2ccc(Cl)c(F)c2)NN)n1 |
| InChI | InChI=1S/C14H15ClFN3/c1-9-3-2-4-13(18-9)14(19-17)8-10-5-6-11(15)12(16)7-10/h2-7,14,19H,8,17H2,1H3 |
| InChIKey | LOUQAUMWPROGGW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.75 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|