C15H21ClFN3O — CID 107895187
[1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(4-chloro-3-fluorophenyl)ethyl]hydrazine (PubChem CID 107895187) has the molecular formula C15H21ClFN3O and a molecular weight of 313.80 g/mol. Its IUPAC name is [1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(4-chloro-3-fluorophenyl)ethyl]hydrazine.
| Compound Name | [1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(4-chloro-3-fluorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 107895187 |
| Molecular Formula | C15H21ClFN3O |
| Molecular Weight | 313.80 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | [1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(4-chloro-3-fluorophenyl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccc(Cl)c(F)c1)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C15H21ClFN3O/c16-12-4-3-10(6-13(12)17)7-14(19-18)15-8-20-5-1-2-11(20)9-21-15/h3-4,6,11,14-15,19H,1-2,5,7-9,18H2 |
| InChIKey | HYDFYFBXMNQDIB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.80 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|