C22H29N3O7 — CID 10789581
2-butoxy-N,N-bis[2-(2-nitrophenoxy)ethyl]ethanamine (PubChem CID 10789581) has the molecular formula C22H29N3O7 and a molecular weight of 447.49 g/mol. Its IUPAC name is 2-butoxy-N,N-bis[2-(2-nitrophenoxy)ethyl]ethanamine.
| Compound Name | 2-butoxy-N,N-bis[2-(2-nitrophenoxy)ethyl]ethanamine |
|---|---|
| PubChem CID | 10789581 |
| Molecular Formula | C22H29N3O7 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 2-butoxy-N,N-bis[2-(2-nitrophenoxy)ethyl]ethanamine |
| SMILES | CCCCOCCN(CCOc1ccccc1[N+](=O)[O-])CCOc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H29N3O7/c1-2-3-15-30-16-12-23(13-17-31-21-10-6-4-8-19(21)24(26)27)14-18-32-22-11-7-5-9-20(22)25(28)29/h4-11H,2-3,12-18H2,1H3 |
| InChIKey | ZNCUAKYKBYGPBA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 117.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|