C16H11Cl2N3O2S — CID 1078967
N-[5-(2,4-dichlorophenyl)-1,3,4-thiadiazol-2-yl]-2-methoxybenzamide (PubChem CID 1078967) has the molecular formula C16H11Cl2N3O2S and a molecular weight of 380.26 g/mol. Its IUPAC name is N-[5-(2,4-dichlorophenyl)-1,3,4-thiadiazol-2-yl]-2-methoxybenzamide.
| Compound Name | N-[5-(2,4-dichlorophenyl)-1,3,4-thiadiazol-2-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 1078967 |
| Molecular Formula | C16H11Cl2N3O2S |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | N-[5-(2,4-dichlorophenyl)-1,3,4-thiadiazol-2-yl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)Nc1nnc(-c2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C16H11Cl2N3O2S/c1-23-13-5-3-2-4-11(13)14(22)19-16-21-20-15(24-16)10-7-6-9(17)8-12(10)18/h2-8H,1H3,(H,19,21,22) |
| InChIKey | NPTVLHMKAKJQBI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |