C11H20ClNO — CID 107897805
4-[(E)-but-2-enyl]-6-(chloromethyl)-2,2-dimethylmorpholine (PubChem CID 107897805) has the molecular formula C11H20ClNO and a molecular weight of 217.74 g/mol. Its IUPAC name is 4-[(E)-but-2-enyl]-6-(chloromethyl)-2,2-dimethylmorpholine.
| Compound Name | 4-[(E)-but-2-enyl]-6-(chloromethyl)-2,2-dimethylmorpholine |
|---|---|
| PubChem CID | 107897805 |
| Molecular Formula | C11H20ClNO |
| Molecular Weight | 217.74 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 4-[(E)-but-2-enyl]-6-(chloromethyl)-2,2-dimethylmorpholine |
| SMILES | C/C=C/CN1CC(CCl)OC(C)(C)C1 |
| InChI | InChI=1S/C11H20ClNO/c1-4-5-6-13-8-10(7-12)14-11(2,3)9-13/h4-5,10H,6-9H2,1-3H3/b5-4+ |
| InChIKey | OMTRTKCPWORAIE-SNAWJCMRSA-N |
| XLogP | 2.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.74 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|