C13H24N2 — CID 107897896
1-[(E)-but-2-enyl]-2-cyclopropyl-2,5-dimethylpiperazine (PubChem CID 107897896) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 1-[(E)-but-2-enyl]-2-cyclopropyl-2,5-dimethylpiperazine.
| Compound Name | 1-[(E)-but-2-enyl]-2-cyclopropyl-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 107897896 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 1-[(E)-but-2-enyl]-2-cyclopropyl-2,5-dimethylpiperazine |
| SMILES | C/C=C/CN1CC(C)NCC1(C)C1CC1 |
| InChI | InChI=1S/C13H24N2/c1-4-5-8-15-9-11(2)14-10-13(15,3)12-6-7-12/h4-5,11-12,14H,6-10H2,1-3H3/b5-4+ |
| InChIKey | MLVXTCNEVVIZHF-SNAWJCMRSA-N |
| XLogP | 2.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|