C15H24N2O2 — CID 107898216
6-[(E)-but-2-enyl]-8-propyl-6,9-diazaspiro[4.5]decane-7,10-dione (PubChem CID 107898216) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 6-[(E)-but-2-enyl]-8-propyl-6,9-diazaspiro[4.5]decane-7,10-dione.
| Compound Name | 6-[(E)-but-2-enyl]-8-propyl-6,9-diazaspiro[4.5]decane-7,10-dione |
|---|---|
| PubChem CID | 107898216 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 6-[(E)-but-2-enyl]-8-propyl-6,9-diazaspiro[4.5]decane-7,10-dione |
| SMILES | C/C=C/CN1C(=O)C(CCC)NC(=O)C12CCCC2 |
| InChI | InChI=1S/C15H24N2O2/c1-3-5-11-17-13(18)12(8-4-2)16-14(19)15(17)9-6-7-10-15/h3,5,12H,4,6-11H2,1-2H3,(H,16,19)/b5-3+ |
| InChIKey | GPBBOIUYTHHNIQ-HWKANZROSA-N |
| XLogP | 2.00 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|