C26H33ClN4O — CID 10789829
1-[4-[(2R)-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperazin-1-yl]-2-(1-methylpiperidin-4-yl)ethanone (PubChem CID 10789829) has the molecular formula C26H33ClN4O and a molecular weight of 453.03 g/mol. Its IUPAC name is 1-[4-[(2R)-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperazin-1-yl]-2-(1-methylpiperidin-4-yl)ethanone.
| Compound Name | 1-[4-[(2R)-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperazin-1-yl]-2-(1-methylpiperidin-4-yl)ethanone |
|---|---|
| PubChem CID | 10789829 |
| Molecular Formula | C26H33ClN4O |
| Molecular Weight | 453.03 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 1-[4-[(2R)-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperazin-1-yl]-2-(1-methylpiperidin-4-yl)ethanone |
| SMILES | CN1CCC(CC(=O)N2CCN([C@@H]3c4ccc(Cl)cc4CCc4cccnc43)CC2)CC1 |
| InChI | InChI=1S/C26H33ClN4O/c1-29-11-8-19(9-12-29)17-24(32)30-13-15-31(16-14-30)26-23-7-6-22(27)18-21(23)5-4-20-3-2-10-28-25(20)26/h2-3,6-7,10,18-19,26H,4-5,8-9,11-17H2,1H3/t26-/m1/s1 |
| InChIKey | FOIATOGDCIIDMZ-AREMUKBSSA-N |
| XLogP | 3.80 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.03 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |