C12H20N2O2 — CID 107898302
1-[(E)-but-2-enyl]-3-ethyl-3,6-dimethylpiperazine-2,5-dione (PubChem CID 107898302) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 1-[(E)-but-2-enyl]-3-ethyl-3,6-dimethylpiperazine-2,5-dione.
| Compound Name | 1-[(E)-but-2-enyl]-3-ethyl-3,6-dimethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 107898302 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 1-[(E)-but-2-enyl]-3-ethyl-3,6-dimethylpiperazine-2,5-dione |
| SMILES | C/C=C/CN1C(=O)C(C)(CC)NC(=O)C1C |
| InChI | InChI=1S/C12H20N2O2/c1-5-7-8-14-9(3)10(15)13-12(4,6-2)11(14)16/h5,7,9H,6,8H2,1-4H3,(H,13,15)/b7-5+ |
| InChIKey | RFVFHVITBUAJBJ-FNORWQNLSA-N |
| XLogP | 1.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|