C17H22N2O2 — CID 107898345
1-[(E)-but-2-enyl]-6-ethyl-6-methyl-3-phenylpiperazine-2,5-dione (PubChem CID 107898345) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 1-[(E)-but-2-enyl]-6-ethyl-6-methyl-3-phenylpiperazine-2,5-dione.
| Compound Name | 1-[(E)-but-2-enyl]-6-ethyl-6-methyl-3-phenylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 107898345 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1-[(E)-but-2-enyl]-6-ethyl-6-methyl-3-phenylpiperazine-2,5-dione |
| SMILES | C/C=C/CN1C(=O)C(c2ccccc2)NC(=O)C1(C)CC |
| InChI | InChI=1S/C17H22N2O2/c1-4-6-12-19-15(20)14(13-10-8-7-9-11-13)18-16(21)17(19,3)5-2/h4,6-11,14H,5,12H2,1-3H3,(H,18,21)/b6-4+ |
| InChIKey | JFHKDVMSGKKODE-GQCTYLIASA-N |
| XLogP | 2.43 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|