C15H22N2O2 — CID 107898352
1-[(E)-but-2-enyl]-3,6-dicyclopropyl-3-methylpiperazine-2,5-dione (PubChem CID 107898352) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-[(E)-but-2-enyl]-3,6-dicyclopropyl-3-methylpiperazine-2,5-dione.
| Compound Name | 1-[(E)-but-2-enyl]-3,6-dicyclopropyl-3-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 107898352 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-[(E)-but-2-enyl]-3,6-dicyclopropyl-3-methylpiperazine-2,5-dione |
| SMILES | C/C=C/CN1C(=O)C(C)(C2CC2)NC(=O)C1C1CC1 |
| InChI | InChI=1S/C15H22N2O2/c1-3-4-9-17-12(10-5-6-10)13(18)16-15(2,14(17)19)11-7-8-11/h3-4,10-12H,5-9H2,1-2H3,(H,16,18)/b4-3+ |
| InChIKey | RZDWWXOVJLJQNN-ONEGZZNKSA-N |
| XLogP | 1.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|