C9H8Cl3N — CID 107899608
3,5-dichloro-N-[(E)-3-chloroprop-2-enyl]aniline (PubChem CID 107899608) has the molecular formula C9H8Cl3N and a molecular weight of 236.53 g/mol. Its IUPAC name is 3,5-dichloro-N-[(E)-3-chloroprop-2-enyl]aniline.
| Compound Name | 3,5-dichloro-N-[(E)-3-chloroprop-2-enyl]aniline |
|---|---|
| PubChem CID | 107899608 |
| Molecular Formula | C9H8Cl3N |
| Molecular Weight | 236.53 g/mol |
| Exact Mass | 234.97 |
| IUPAC Name | 3,5-dichloro-N-[(E)-3-chloroprop-2-enyl]aniline |
| SMILES | Cl/C=C/CNc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C9H8Cl3N/c10-2-1-3-13-9-5-7(11)4-8(12)6-9/h1-2,4-6,13H,3H2/b2-1+ |
| InChIKey | OMIXTLMURFYRCK-OWOJBTEDSA-N |
| XLogP | 4.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |