C10H8Cl2F3N — CID 107899669
4-chloro-N-[(E)-3-chloroprop-2-enyl]-3-(trifluoromethyl)aniline (PubChem CID 107899669) has the molecular formula C10H8Cl2F3N and a molecular weight of 270.08 g/mol. Its IUPAC name is 4-chloro-N-[(E)-3-chloroprop-2-enyl]-3-(trifluoromethyl)aniline.
| Compound Name | 4-chloro-N-[(E)-3-chloroprop-2-enyl]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 107899669 |
| Molecular Formula | C10H8Cl2F3N |
| Molecular Weight | 270.08 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | 4-chloro-N-[(E)-3-chloroprop-2-enyl]-3-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1cc(NC/C=C/Cl)ccc1Cl |
| InChI | InChI=1S/C10H8Cl2F3N/c11-4-1-5-16-7-2-3-9(12)8(6-7)10(13,14)15/h1-4,6,16H,5H2/b4-1+ |
| InChIKey | XLBIESPXOAMZHK-DAFODLJHSA-N |
| XLogP | 4.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.08 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |