C11H11ClF3N — CID 107899908
(E)-3-chloro-N-[[2-(trifluoromethyl)phenyl]methyl]prop-2-en-1-amine (PubChem CID 107899908) has the molecular formula C11H11ClF3N and a molecular weight of 249.66 g/mol. Its IUPAC name is (E)-3-chloro-N-[[2-(trifluoromethyl)phenyl]methyl]prop-2-en-1-amine.
| Compound Name | (E)-3-chloro-N-[[2-(trifluoromethyl)phenyl]methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 107899908 |
| Molecular Formula | C11H11ClF3N |
| Molecular Weight | 249.66 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | (E)-3-chloro-N-[[2-(trifluoromethyl)phenyl]methyl]prop-2-en-1-amine |
| SMILES | FC(F)(F)c1ccccc1CNC/C=C/Cl |
| InChI | InChI=1S/C11H11ClF3N/c12-6-3-7-16-8-9-4-1-2-5-10(9)11(13,14)15/h1-6,16H,7-8H2/b6-3+ |
| InChIKey | MEAAKOCZHUBXMR-ZZXKWVIFSA-N |
| XLogP | 3.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.66 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|