C22H33ClN2O2S2 — CID 10790003
(1S,2S,4aR,5R,8R,8aR)-8-[(2S,5R)-5-chloro-2,6,6-trimethyloxan-2-yl]-1,5-diisothiocyanato-2,5-dimethyl-1,3,4,4a,6,7,8,8a-octahydronaphthalen-2-ol (PubChem CID 10790003) has the molecular formula C22H33ClN2O2S2 and a molecular weight of 457.11 g/mol. Its IUPAC name is (1S,2S,4aR,5R,8R,8aR)-8-[(2S,5R)-5-chloro-2,6,6-trimethyloxan-2-yl]-1,5-diisothiocyanato-2,5-dimethyl-1,3,4,4a,6,7,8,8a-octahydronaphthalen-2-ol.
| Compound Name | (1S,2S,4aR,5R,8R,8aR)-8-[(2S,5R)-5-chloro-2,6,6-trimethyloxan-2-yl]-1,5-diisothiocyanato-2,5-dimethyl-1,3,4,4a,6,7,8,8a-octahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 10790003 |
| Molecular Formula | C22H33ClN2O2S2 |
| Molecular Weight | 457.11 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | (1S,2S,4aR,5R,8R,8aR)-8-[(2S,5R)-5-chloro-2,6,6-trimethyloxan-2-yl]-1,5-diisothiocyanato-2,5-dimethyl-1,3,4,4a,6,7,8,8a-octahydronaphthalen-2-ol |
| SMILES | CC1(C)O[C@](C)([C@@H]2CC[C@@](C)(N=C=S)[C@@H]3CC[C@](C)(O)[C@@H](N=C=S)[C@H]32)CC[C@H]1Cl |
| InChI | InChI=1S/C22H33ClN2O2S2/c1-19(2)16(23)8-11-22(5,27-19)15-6-9-20(3,25-13-29)14-7-10-21(4,26)18(17(14)15)24-12-28/h14-18,26H,6-11H2,1-5H3/t14-,15-,16-,17-,18+,20-,21+,22+/m1/s1 |
| InChIKey | MSRJKIPSWOKGIA-CGYKTZFGSA-N |
| XLogP | 5.46 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.11 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|