C17H34N2 — CID 107901804
2-butan-2-yl-5,5-diethyl-1-(3-methylbut-2-enyl)piperazine (PubChem CID 107901804) has the molecular formula C17H34N2 and a molecular weight of 266.47 g/mol. Its IUPAC name is 2-butan-2-yl-5,5-diethyl-1-(3-methylbut-2-enyl)piperazine.
| Compound Name | 2-butan-2-yl-5,5-diethyl-1-(3-methylbut-2-enyl)piperazine |
|---|---|
| PubChem CID | 107901804 |
| Molecular Formula | C17H34N2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.27 |
| IUPAC Name | 2-butan-2-yl-5,5-diethyl-1-(3-methylbut-2-enyl)piperazine |
| SMILES | CCC(C)C1CNC(CC)(CC)CN1CC=C(C)C |
| InChI | InChI=1S/C17H34N2/c1-7-15(6)16-12-18-17(8-2,9-3)13-19(16)11-10-14(4)5/h10,15-16,18H,7-9,11-13H2,1-6H3 |
| InChIKey | KMMVJVSSBRPNTK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|