About 2-butan-2-yl-5,5-diethyl-1-(3-methylbut-2-enyl)piperazine
2-butan-2-yl-5,5-diethyl-1-(3-methylbut-2-enyl)piperazine (PubChem CID 107901804) has the molecular formula C17H34N2
and a molecular weight of 266.47 g/mol. Its IUPAC name is 2-butan-2-yl-5,5-diethyl-1-(3-methylbut-2-enyl)piperazine.
Molecular Properties
| Compound Name | 2-butan-2-yl-5,5-diethyl-1-(3-methylbut-2-enyl)piperazine |
| PubChem CID | 107901804 |
| Molecular Formula | C17H34N2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.27 |
| IUPAC Name | 2-butan-2-yl-5,5-diethyl-1-(3-methylbut-2-enyl)piperazine |
| SMILES | CCC(C)C1CNC(CC)(CC)CN1CC=C(C)C |
| InChI | InChI=1S/C17H34N2/c1-7-15(6)16-12-18-17(8-2,9-3)13-19(16)11-10-14(4)5/h10,15-16,18H,7-9,11-13H2,1-6H3 |
| InChIKey | KMMVJVSSBRPNTK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-butan-2-yl-5,5-diethyl-1-(3-methylbut-2-enyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yl-5,5-diethyl-1-(3-methylbut-2-enyl)piperazine?
The IUPAC name of 2-butan-2-yl-5,5-diethyl-1-(3-methylbut-2-enyl)piperazine (CID 107901804) is 2-butan-2-yl-5,5-diethyl-1-(3-methylbut-2-enyl)piperazine.
What is the SMILES notation for 2-butan-2-yl-5,5-diethyl-1-(3-methylbut-2-enyl)piperazine?
The canonical SMILES for 2-butan-2-yl-5,5-diethyl-1-(3-methylbut-2-enyl)piperazine is CCC(C)C1CNC(CC)(CC)CN1CC=C(C)C.
What is the InChIKey of 2-butan-2-yl-5,5-diethyl-1-(3-methylbut-2-enyl)piperazine?
The InChIKey is KMMVJVSSBRPNTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34N2/c1-7-15(6)16-12-18-17(8-2,9-3)13-19(16)11-10-14(4)5/h10,15-16,18H,7-9,11-13H2,1-6H3.
What are the key properties of 2-butan-2-yl-5,5-diethyl-1-(3-methylbut-2-enyl)piperazine?
2-butan-2-yl-5,5-diethyl-1-(3-methylbut-2-enyl)piperazine has a molecular weight of 266.47 g/mol, XLogP of 3.83, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yl-5,5-diethyl-1-(3-methylbut-2-enyl)piperazine is sourced from PubChem (CID 107901804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).