C15H25ClN2O2 — CID 107902198
3,6-di(butan-2-yl)-1-[(E)-3-chloroprop-2-enyl]piperazine-2,5-dione (PubChem CID 107902198) has the molecular formula C15H25ClN2O2 and a molecular weight of 300.83 g/mol. Its IUPAC name is 3,6-di(butan-2-yl)-1-[(E)-3-chloroprop-2-enyl]piperazine-2,5-dione.
| Compound Name | 3,6-di(butan-2-yl)-1-[(E)-3-chloroprop-2-enyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 107902198 |
| Molecular Formula | C15H25ClN2O2 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 3,6-di(butan-2-yl)-1-[(E)-3-chloroprop-2-enyl]piperazine-2,5-dione |
| SMILES | CCC(C)C1NC(=O)C(C(C)CC)N(C/C=C/Cl)C1=O |
| InChI | InChI=1S/C15H25ClN2O2/c1-5-10(3)12-15(20)18(9-7-8-16)13(11(4)6-2)14(19)17-12/h7-8,10-13H,5-6,9H2,1-4H3,(H,17,19)/b8-7+ |
| InChIKey | WURGJKLEEDQTOQ-BQYQJAHWSA-N |
| XLogP | 2.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |