About 4-fluoro-2-[(1-oxo-3,4-dihydroisoquinolin-2-yl)methyl]benzonitrile
4-fluoro-2-[(1-oxo-3,4-dihydroisoquinolin-2-yl)methyl]benzonitrile (PubChem CID 107903076) has the molecular formula C17H13FN2O
and a molecular weight of 280.30 g/mol. Its IUPAC name is 4-fluoro-2-[(1-oxo-3,4-dihydroisoquinolin-2-yl)methyl]benzonitrile.
Molecular Properties
| Compound Name | 4-fluoro-2-[(1-oxo-3,4-dihydroisoquinolin-2-yl)methyl]benzonitrile |
| PubChem CID | 107903076 |
| Molecular Formula | C17H13FN2O |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 4-fluoro-2-[(1-oxo-3,4-dihydroisoquinolin-2-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccc(F)cc1CN1CCc2ccccc2C1=O |
| InChI | InChI=1S/C17H13FN2O/c18-15-6-5-13(10-19)14(9-15)11-20-8-7-12-3-1-2-4-16(12)17(20)21/h1-6,9H,7-8,11H2 |
| InChIKey | ABMZIMQCNBRXMU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-fluoro-2-[(1-oxo-3,4-dihydroisoquinolin-2-yl)methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2-[(1-oxo-3,4-dihydroisoquinolin-2-yl)methyl]benzonitrile?
The IUPAC name of 4-fluoro-2-[(1-oxo-3,4-dihydroisoquinolin-2-yl)methyl]benzonitrile (CID 107903076) is 4-fluoro-2-[(1-oxo-3,4-dihydroisoquinolin-2-yl)methyl]benzonitrile.
What is the SMILES notation for 4-fluoro-2-[(1-oxo-3,4-dihydroisoquinolin-2-yl)methyl]benzonitrile?
The canonical SMILES for 4-fluoro-2-[(1-oxo-3,4-dihydroisoquinolin-2-yl)methyl]benzonitrile is N#Cc1ccc(F)cc1CN1CCc2ccccc2C1=O.
What is the InChIKey of 4-fluoro-2-[(1-oxo-3,4-dihydroisoquinolin-2-yl)methyl]benzonitrile?
The InChIKey is ABMZIMQCNBRXMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13FN2O/c18-15-6-5-13(10-19)14(9-15)11-20-8-7-12-3-1-2-4-16(12)17(20)21/h1-6,9H,7-8,11H2.
What are the key properties of 4-fluoro-2-[(1-oxo-3,4-dihydroisoquinolin-2-yl)methyl]benzonitrile?
4-fluoro-2-[(1-oxo-3,4-dihydroisoquinolin-2-yl)methyl]benzonitrile has a molecular weight of 280.30 g/mol, XLogP of 2.90, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2-[(1-oxo-3,4-dihydroisoquinolin-2-yl)methyl]benzonitrile is sourced from PubChem (CID 107903076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).