C13H17FN2 — CID 107903665
4-fluoro-2-[(pentan-2-ylamino)methyl]benzonitrile (PubChem CID 107903665) has the molecular formula C13H17FN2 and a molecular weight of 220.29 g/mol. Its IUPAC name is 4-fluoro-2-[(pentan-2-ylamino)methyl]benzonitrile.
| Compound Name | 4-fluoro-2-[(pentan-2-ylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 107903665 |
| Molecular Formula | C13H17FN2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 4-fluoro-2-[(pentan-2-ylamino)methyl]benzonitrile |
| SMILES | CCCC(C)NCc1cc(F)ccc1C#N |
| InChI | InChI=1S/C13H17FN2/c1-3-4-10(2)16-9-12-7-13(14)6-5-11(12)8-15/h5-7,10,16H,3-4,9H2,1-2H3 |
| InChIKey | MJMRQMVZKTVWCZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |