C23H30O10 — CID 10790368
(2R,3R,4R,5R)-5-[(1S,2R)-3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-2-(2-methoxyphenoxy)propoxy]-2-methoxyoxane-3,4-diol (PubChem CID 10790368) has the molecular formula C23H30O10 and a molecular weight of 466.48 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-[(1S,2R)-3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-2-(2-methoxyphenoxy)propoxy]-2-methoxyoxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-5-[(1S,2R)-3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-2-(2-methoxyphenoxy)propoxy]-2-methoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 10790368 |
| Molecular Formula | C23H30O10 |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | (2R,3R,4R,5R)-5-[(1S,2R)-3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-2-(2-methoxyphenoxy)propoxy]-2-methoxyoxane-3,4-diol |
| SMILES | COc1cc([C@H](O[C@@H]2CO[C@@H](OC)[C@H](O)[C@H]2O)[C@@H](CO)Oc2ccccc2OC)ccc1O |
| InChI | InChI=1S/C23H30O10/c1-28-15-6-4-5-7-16(15)32-18(11-24)22(13-8-9-14(25)17(10-13)29-2)33-19-12-31-23(30-3)21(27)20(19)26/h4-10,18-27H,11-12H2,1-3H3/t18-,19-,20+,21-,22+,23-/m1/s1 |
| InChIKey | PGVSAGSWXCINLS-IROFBDHCSA-N |
| XLogP | 1.00 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |