C34H30Si — CID 10790388
7,8-dimethyl-1,2,3,4-tetraphenyl-5-silaspiro[4.4]nona-1,3,7-triene (PubChem CID 10790388) has the molecular formula C34H30Si and a molecular weight of 466.70 g/mol. Its IUPAC name is 7,8-dimethyl-1,2,3,4-tetraphenyl-5-silaspiro[4.4]nona-1,3,7-triene.
| Compound Name | 7,8-dimethyl-1,2,3,4-tetraphenyl-5-silaspiro[4.4]nona-1,3,7-triene |
|---|---|
| PubChem CID | 10790388 |
| Molecular Formula | C34H30Si |
| Molecular Weight | 466.70 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 7,8-dimethyl-1,2,3,4-tetraphenyl-5-silaspiro[4.4]nona-1,3,7-triene |
| SMILES | CC1=C(C)C[Si]2(C1)C(c1ccccc1)=C(c1ccccc1)C(c1ccccc1)=C2c1ccccc1 |
| InChI | InChI=1S/C34H30Si/c1-25-23-35(24-26(25)2)33(29-19-11-5-12-20-29)31(27-15-7-3-8-16-27)32(28-17-9-4-10-18-28)34(35)30-21-13-6-14-22-30/h3-22H,23-24H2,1-2H3 |
| InChIKey | BNRNYYMSQQLUAN-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.70 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|