C31H31ClN2 — CID 10790395
(2S)-3-benzhydrylimino-N,N-dibenzyl-4-chlorobutan-2-amine (PubChem CID 10790395) has the molecular formula C31H31ClN2 and a molecular weight of 467.06 g/mol. Its IUPAC name is (2S)-3-benzhydrylimino-N,N-dibenzyl-4-chlorobutan-2-amine.
| Compound Name | (2S)-3-benzhydrylimino-N,N-dibenzyl-4-chlorobutan-2-amine |
|---|---|
| PubChem CID | 10790395 |
| Molecular Formula | C31H31ClN2 |
| Molecular Weight | 467.06 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | (2S)-3-benzhydrylimino-N,N-dibenzyl-4-chlorobutan-2-amine |
| SMILES | C[C@@H](/C(CCl)=N/C(c1ccccc1)c1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C31H31ClN2/c1-25(34(23-26-14-6-2-7-15-26)24-27-16-8-3-9-17-27)30(22-32)33-31(28-18-10-4-11-19-28)29-20-12-5-13-21-29/h2-21,25,31H,22-24H2,1H3/b33-30+/t25-/m0/s1 |
| InChIKey | JDDAVBBLASAGIZ-KINMYHPNSA-N |
| XLogP | 7.55 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.06 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|