C14H9Br2FN2 — CID 107904052
2-[(2,5-dibromoanilino)methyl]-4-fluorobenzonitrile (PubChem CID 107904052) has the molecular formula C14H9Br2FN2 and a molecular weight of 384.05 g/mol. Its IUPAC name is 2-[(2,5-dibromoanilino)methyl]-4-fluorobenzonitrile.
| Compound Name | 2-[(2,5-dibromoanilino)methyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 107904052 |
| Molecular Formula | C14H9Br2FN2 |
| Molecular Weight | 384.05 g/mol |
| Exact Mass | 381.91 |
| IUPAC Name | 2-[(2,5-dibromoanilino)methyl]-4-fluorobenzonitrile |
| SMILES | N#Cc1ccc(F)cc1CNc1cc(Br)ccc1Br |
| InChI | InChI=1S/C14H9Br2FN2/c15-11-2-4-13(16)14(6-11)19-8-10-5-12(17)3-1-9(10)7-18/h1-6,19H,8H2 |
| InChIKey | VQEJHDAPKQEZQW-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.05 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |