C10H14BrN3O3 — CID 107905582
9-(2-bromopropanoyl)-1,3,9-triazaspiro[4.5]decane-2,4-dione (PubChem CID 107905582) has the molecular formula C10H14BrN3O3 and a molecular weight of 304.14 g/mol. Its IUPAC name is 9-(2-bromopropanoyl)-1,3,9-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 9-(2-bromopropanoyl)-1,3,9-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 107905582 |
| Molecular Formula | C10H14BrN3O3 |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 9-(2-bromopropanoyl)-1,3,9-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CC(Br)C(=O)N1CCCC2(C1)NC(=O)NC2=O |
| InChI | InChI=1S/C10H14BrN3O3/c1-6(11)7(15)14-4-2-3-10(5-14)8(16)12-9(17)13-10/h6H,2-5H2,1H3,(H2,12,13,16,17) |
| InChIKey | LBOIWPGPIYRBKC-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|